C11H15N3O2 — CID 116579697
(2-amino-5-methyl-3-pyridinyl)-(3-aminooxolan-3-yl)methanone (PubChem CID 116579697) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is (2-amino-5-methyl-3-pyridinyl)-(3-aminooxolan-3-yl)methanone.
| Compound Name | (2-amino-5-methyl-3-pyridinyl)-(3-aminooxolan-3-yl)methanone |
|---|---|
| PubChem CID | 116579697 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2-amino-5-methyl-3-pyridinyl)-(3-aminooxolan-3-yl)methanone |
| SMILES | Cc1cnc(N)c(C(=O)C2(N)CCOC2)c1 |
| InChI | InChI=1S/C11H15N3O2/c1-7-4-8(10(12)14-5-7)9(15)11(13)2-3-16-6-11/h4-5H,2-3,6,13H2,1H3,(H2,12,14) |
| InChIKey | CHPXFKGEXWEFEX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |