C17H16BrNO2 — CID 116582084
1-(4-amino-3-bromophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanone (PubChem CID 116582084) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 1-(4-amino-3-bromophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanone.
| Compound Name | 1-(4-amino-3-bromophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanone |
|---|---|
| PubChem CID | 116582084 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-(4-amino-3-bromophenyl)-2-(3,4-dihydro-1H-isochromen-1-yl)ethanone |
| SMILES | Nc1ccc(C(=O)CC2OCCc3ccccc32)cc1Br |
| InChI | InChI=1S/C17H16BrNO2/c18-14-9-12(5-6-15(14)19)16(20)10-17-13-4-2-1-3-11(13)7-8-21-17/h1-6,9,17H,7-8,10,19H2 |
| InChIKey | ROMXKRKFFQJYCC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|