C12H12BrNO2 — CID 116582131
(4-amino-3-bromophenyl)-(3,4-dihydro-2H-pyran-5-yl)methanone (PubChem CID 116582131) has the molecular formula C12H12BrNO2 and a molecular weight of 282.14 g/mol. Its IUPAC name is (4-amino-3-bromophenyl)-(3,4-dihydro-2H-pyran-5-yl)methanone.
| Compound Name | (4-amino-3-bromophenyl)-(3,4-dihydro-2H-pyran-5-yl)methanone |
|---|---|
| PubChem CID | 116582131 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | (4-amino-3-bromophenyl)-(3,4-dihydro-2H-pyran-5-yl)methanone |
| SMILES | Nc1ccc(C(=O)C2=COCCC2)cc1Br |
| InChI | InChI=1S/C12H12BrNO2/c13-10-6-8(3-4-11(10)14)12(15)9-2-1-5-16-7-9/h3-4,6-7H,1-2,5,14H2 |
| InChIKey | JMAPMMMZMJNSJT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|