About 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone
1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone (PubChem CID 116584290) has the molecular formula C13H20N2OS
and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone |
| PubChem CID | 116584290 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone |
| SMILES | Cc1nc(CC(=O)C2CCCC2CN)sc1C |
| InChI | InChI=1S/C13H20N2OS/c1-8-9(2)17-13(15-8)6-12(16)11-5-3-4-10(11)7-14/h10-11H,3-7,14H2,1-2H3 |
| InChIKey | WJOLEFQSSZTFOQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone?
The IUPAC name of 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone (CID 116584290) is 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone.
What is the SMILES notation for 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone?
The canonical SMILES for 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone is Cc1nc(CC(=O)C2CCCC2CN)sc1C.
What is the InChIKey of 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone?
The InChIKey is WJOLEFQSSZTFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2OS/c1-8-9(2)17-13(15-8)6-12(16)11-5-3-4-10(11)7-14/h10-11H,3-7,14H2,1-2H3.
What are the key properties of 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone?
1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone has a molecular weight of 252.38 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(aminomethyl)cyclopentyl]-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethanone is sourced from PubChem (CID 116584290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).