About 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene
6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene (PubChem CID 11658439) has the molecular formula C11H11FO2
and a molecular weight of 194.21 g/mol. Its IUPAC name is 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene |
| PubChem CID | 11658439 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene |
| SMILES | Fc1ccc2c(c1)CCC(C1CO1)O2 |
| InChI | InChI=1S/C11H11FO2/c12-8-2-4-9-7(5-8)1-3-10(14-9)11-6-13-11/h2,4-5,10-11H,1,3,6H2 |
| InChIKey | GVZDIJGBXSDSEP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene?
The IUPAC name of 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene (CID 11658439) is 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene.
What is the SMILES notation for 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene?
The canonical SMILES for 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene is Fc1ccc2c(c1)CCC(C1CO1)O2.
What is the InChIKey of 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene?
The InChIKey is GVZDIJGBXSDSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO2/c12-8-2-4-9-7(5-8)1-3-10(14-9)11-6-13-11/h2,4-5,10-11H,1,3,6H2.
What are the key properties of 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene?
6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene has a molecular weight of 194.21 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-(oxiran-2-yl)-3,4-dihydro-2H-chromene is sourced from PubChem (CID 11658439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).