C14H16N2O2S — CID 116585367
[2-(2-aminoethyl)-1,3-thiazol-4-yl]-(2-ethoxyphenyl)methanone (PubChem CID 116585367) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is [2-(2-aminoethyl)-1,3-thiazol-4-yl]-(2-ethoxyphenyl)methanone.
| Compound Name | [2-(2-aminoethyl)-1,3-thiazol-4-yl]-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 116585367 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [2-(2-aminoethyl)-1,3-thiazol-4-yl]-(2-ethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C(=O)c1csc(CCN)n1 |
| InChI | InChI=1S/C14H16N2O2S/c1-2-18-12-6-4-3-5-10(12)14(17)11-9-19-13(16-11)7-8-15/h3-6,9H,2,7-8,15H2,1H3 |
| InChIKey | NSQVETIEQDGAGG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |