C10H15NO2S — CID 11658566
3-[(3S)-2,4-dimethylpent-1-en-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 11658566) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-[(3S)-2,4-dimethylpent-1-en-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3S)-2,4-dimethylpent-1-en-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11658566 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-[(3S)-2,4-dimethylpent-1-en-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | C=C(C)[C@H](C(C)C)N1C(=O)CSC1=O |
| InChI | InChI=1S/C10H15NO2S/c1-6(2)9(7(3)4)11-8(12)5-14-10(11)13/h7,9H,1,5H2,2-4H3/t9-/m1/s1 |
| InChIKey | BSSKMQFGHQNYPC-SECBINFHSA-N |
| XLogP | 2.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|