About (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one
(5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one (PubChem CID 11658624) has the molecular formula C13H22OSi
and a molecular weight of 222.40 g/mol. Its IUPAC name is (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one.
Molecular Properties
| Compound Name | (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one |
| PubChem CID | 11658624 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one |
| SMILES | C=CC/C=C(\C(=O)C(=C)CC)[Si](C)(C)C |
| InChI | InChI=1S/C13H22OSi/c1-7-9-10-12(15(4,5)6)13(14)11(3)8-2/h7,10H,1,3,8-9H2,2,4-6H3/b12-10+ |
| InChIKey | VYHBHDDRUFTTAO-ZRDIBKRKSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one?
The IUPAC name of (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one (CID 11658624) is (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one.
What is the SMILES notation for (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one?
The canonical SMILES for (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one is C=CC/C=C(\C(=O)C(=C)CC)[Si](C)(C)C.
What is the InChIKey of (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one?
The InChIKey is VYHBHDDRUFTTAO-ZRDIBKRKSA-N. The full InChI is InChI=1S/C13H22OSi/c1-7-9-10-12(15(4,5)6)13(14)11(3)8-2/h7,10H,1,3,8-9H2,2,4-6H3/b12-10+.
What are the key properties of (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one?
(5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one has a molecular weight of 222.40 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-methylidene-5-trimethylsilylnona-5,8-dien-4-one is sourced from PubChem (CID 11658624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).