C14H25NO — CID 11658630
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylpropanamide (PubChem CID 11658630) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylpropanamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 11658630 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylpropanamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)C(C)C |
| InChI | InChI=1S/C14H25NO/c1-11(2)7-6-8-13(5)9-10-15-14(16)12(3)4/h7,9,12H,6,8,10H2,1-5H3,(H,15,16)/b13-9+ |
| InChIKey | JWXZMRKGDGVJGU-UKTHLTGXSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|