C11H15NOS2 — CID 116586505
1-(5-methylthiophen-2-yl)-2-thiomorpholin-3-ylethanone (PubChem CID 116586505) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)-2-thiomorpholin-3-ylethanone.
| Compound Name | 1-(5-methylthiophen-2-yl)-2-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 116586505 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)-2-thiomorpholin-3-ylethanone |
| SMILES | Cc1ccc(C(=O)CC2CSCCN2)s1 |
| InChI | InChI=1S/C11H15NOS2/c1-8-2-3-11(15-8)10(13)6-9-7-14-5-4-12-9/h2-3,9,12H,4-7H2,1H3 |
| InChIKey | SUQVNZOCKOSFFX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |