C14H18O3 — CID 11658704
(1R,4R,7S,8S,12S)-1-methoxy-7,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one (PubChem CID 11658704) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1R,4R,7S,8S,12S)-1-methoxy-7,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one.
| Compound Name | (1R,4R,7S,8S,12S)-1-methoxy-7,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one |
|---|---|
| PubChem CID | 11658704 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1R,4R,7S,8S,12S)-1-methoxy-7,9-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-dien-11-one |
| SMILES | CO[C@]12OC[C@@H]3C=C[C@H](C)[C@H](C(C)=CC1=O)[C@@H]32 |
| InChI | InChI=1S/C14H18O3/c1-8-4-5-10-7-17-14(16-3)11(15)6-9(2)12(8)13(10)14/h4-6,8,10,12-13H,7H2,1-3H3/t8-,10-,12+,13+,14-/m0/s1 |
| InChIKey | ZHHVKXJGQQDSPK-ZVFRIGBMSA-N |
| XLogP | 1.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|