C11H18F3NO2 — CID 116588116
1-[4-(ethylamino)oxolan-3-yl]-5,5,5-trifluoropentan-1-one (PubChem CID 116588116) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-[4-(ethylamino)oxolan-3-yl]-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-[4-(ethylamino)oxolan-3-yl]-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 116588116 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[4-(ethylamino)oxolan-3-yl]-5,5,5-trifluoropentan-1-one |
| SMILES | CCNC1COCC1C(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H18F3NO2/c1-2-15-9-7-17-6-8(9)10(16)4-3-5-11(12,13)14/h8-9,15H,2-7H2,1H3 |
| InChIKey | ZDISZVHXOYSIPO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |