C14H22BrN3O2 — CID 116588170
2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-[4-(ethylamino)oxolan-3-yl]ethanone (PubChem CID 116588170) has the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. Its IUPAC name is 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-[4-(ethylamino)oxolan-3-yl]ethanone.
| Compound Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-[4-(ethylamino)oxolan-3-yl]ethanone |
|---|---|
| PubChem CID | 116588170 |
| Molecular Formula | C14H22BrN3O2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-1-[4-(ethylamino)oxolan-3-yl]ethanone |
| SMILES | CCNC1COCC1C(=O)Cc1c(Br)c(CC)nn1C |
| InChI | InChI=1S/C14H22BrN3O2/c1-4-10-14(15)12(18(3)17-10)6-13(19)9-7-20-8-11(9)16-5-2/h9,11,16H,4-8H2,1-3H3 |
| InChIKey | WZZWUVOBYSWYAK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |