About 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one
3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one (PubChem CID 116588641) has the molecular formula C8H14F3NO
and a molecular weight of 197.20 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one.
Analyze 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one?
The IUPAC name of 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one (CID 116588641) is 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one.
What is the SMILES notation for 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one?
The canonical SMILES for 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one is CC(C)(C)C(=O)CNCC(F)(F)F.
What is the InChIKey of 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one?
The InChIKey is FDMCARYKSMKNOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO/c1-7(2,3)6(13)4-12-5-8(9,10)11/h12H,4-5H2,1-3H3.
What are the key properties of 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one?
3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one has a molecular weight of 197.20 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(2,2,2-trifluoroethylamino)butan-2-one is sourced from PubChem (CID 116588641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).