C10H8Cl2F3NO — CID 116588698
1-(3,4-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanone (PubChem CID 116588698) has the molecular formula C10H8Cl2F3NO and a molecular weight of 286.08 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanone |
|---|---|
| PubChem CID | 116588698 |
| Molecular Formula | C10H8Cl2F3NO |
| Molecular Weight | 286.08 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(2,2,2-trifluoroethylamino)ethanone |
| SMILES | O=C(CNCC(F)(F)F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2F3NO/c11-7-2-1-6(3-8(7)12)9(17)4-16-5-10(13,14)15/h1-3,16H,4-5H2 |
| InChIKey | ZWSBJDXNSMSLSQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.08 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |