C12H23NO2 — CID 116589055
1-[5-(aminomethyl)oxolan-2-yl]-4,4-dimethylpentan-1-one (PubChem CID 116589055) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[5-(aminomethyl)oxolan-2-yl]-4,4-dimethylpentan-1-one.
| Compound Name | 1-[5-(aminomethyl)oxolan-2-yl]-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 116589055 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-[5-(aminomethyl)oxolan-2-yl]-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)C1CCC(CN)O1 |
| InChI | InChI=1S/C12H23NO2/c1-12(2,3)7-6-10(14)11-5-4-9(8-13)15-11/h9,11H,4-8,13H2,1-3H3 |
| InChIKey | JYWLXOPZONFVEB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |