About methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate
methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate (PubChem CID 11658918) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate.
Molecular Properties
| Compound Name | methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate |
| PubChem CID | 11658918 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate |
| SMILES | COC(=O)CCC(=O)/C=C/C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H20O5/c1-13(2)17-9-11(18-13)6-4-5-10(14)7-8-12(15)16-3/h4-5,11H,6-9H2,1-3H3/b5-4+/t11-/m1/s1 |
| InChIKey | LUOGJVMGEDXRTD-SGUJLRQBSA-N |
| XLogP | 1.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate?
The IUPAC name of methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate (CID 11658918) is methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate.
What is the SMILES notation for methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate?
The canonical SMILES for methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate is COC(=O)CCC(=O)/C=C/C[C@@H]1COC(C)(C)O1.
What is the InChIKey of methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate?
The InChIKey is LUOGJVMGEDXRTD-SGUJLRQBSA-N. The full InChI is InChI=1S/C13H20O5/c1-13(2)17-9-11(18-13)6-4-5-10(14)7-8-12(15)16-3/h4-5,11H,6-9H2,1-3H3/b5-4+/t11-/m1/s1.
What are the key properties of methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate?
methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate has a molecular weight of 256.30 g/mol, XLogP of 1.61, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxohept-5-enoate is sourced from PubChem (CID 11658918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).