C11H13BrN2O — CID 116589928
1-(5-bromo-3-pyridinyl)-3-(prop-2-enylamino)propan-2-one (PubChem CID 116589928) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-3-(prop-2-enylamino)propan-2-one.
| Compound Name | 1-(5-bromo-3-pyridinyl)-3-(prop-2-enylamino)propan-2-one |
|---|---|
| PubChem CID | 116589928 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-3-(prop-2-enylamino)propan-2-one |
| SMILES | C=CCNCC(=O)Cc1cncc(Br)c1 |
| InChI | InChI=1S/C11H13BrN2O/c1-2-3-13-8-11(15)5-9-4-10(12)7-14-6-9/h2,4,6-7,13H,1,3,5,8H2 |
| InChIKey | JCPPVVOKQOIUDX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|