C11H13F2NO — CID 116590230
2-amino-1-(3,4-difluorophenyl)-2-methylbutan-1-one (PubChem CID 116590230) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-amino-1-(3,4-difluorophenyl)-2-methylbutan-1-one.
| Compound Name | 2-amino-1-(3,4-difluorophenyl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 116590230 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-amino-1-(3,4-difluorophenyl)-2-methylbutan-1-one |
| SMILES | CCC(C)(N)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13F2NO/c1-3-11(2,14)10(15)7-4-5-8(12)9(13)6-7/h4-6H,3,14H2,1-2H3 |
| InChIKey | LVUUQVYYEJXMJC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |