C12H10Cl2N4O — CID 116590655
[1-(azetidin-3-yl)triazol-4-yl]-(2,5-dichlorophenyl)methanone (PubChem CID 116590655) has the molecular formula C12H10Cl2N4O and a molecular weight of 297.14 g/mol. Its IUPAC name is [1-(azetidin-3-yl)triazol-4-yl]-(2,5-dichlorophenyl)methanone.
| Compound Name | [1-(azetidin-3-yl)triazol-4-yl]-(2,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 116590655 |
| Molecular Formula | C12H10Cl2N4O |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | [1-(azetidin-3-yl)triazol-4-yl]-(2,5-dichlorophenyl)methanone |
| SMILES | O=C(c1cn(C2CNC2)nn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H10Cl2N4O/c13-7-1-2-10(14)9(3-7)12(19)11-6-18(17-16-11)8-4-15-5-8/h1-3,6,8,15H,4-5H2 |
| InChIKey | VEHZTAGBTAWZTG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |