C12H15F2NO2 — CID 116593859
2-amino-1-(3,5-difluorophenyl)-5-methoxypentan-1-one (PubChem CID 116593859) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-amino-1-(3,5-difluorophenyl)-5-methoxypentan-1-one.
| Compound Name | 2-amino-1-(3,5-difluorophenyl)-5-methoxypentan-1-one |
|---|---|
| PubChem CID | 116593859 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-amino-1-(3,5-difluorophenyl)-5-methoxypentan-1-one |
| SMILES | COCCCC(N)C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2NO2/c1-17-4-2-3-11(15)12(16)8-5-9(13)7-10(14)6-8/h5-7,11H,2-4,15H2,1H3 |
| InChIKey | LXYRJQSYKVRELL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|