C16H21BrFNO — CID 116594286
1-(2-bromo-4-fluorophenyl)-4-piperidin-3-ylpentan-2-one (PubChem CID 116594286) has the molecular formula C16H21BrFNO and a molecular weight of 342.25 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-4-piperidin-3-ylpentan-2-one.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-4-piperidin-3-ylpentan-2-one |
|---|---|
| PubChem CID | 116594286 |
| Molecular Formula | C16H21BrFNO |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-4-piperidin-3-ylpentan-2-one |
| SMILES | CC(CC(=O)Cc1ccc(F)cc1Br)C1CCCNC1 |
| InChI | InChI=1S/C16H21BrFNO/c1-11(13-3-2-6-19-10-13)7-15(20)8-12-4-5-14(18)9-16(12)17/h4-5,9,11,13,19H,2-3,6-8,10H2,1H3 |
| InChIKey | KLZPKHXIVDGFEH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |