C8H17BrN2O5 — CID 11659435
2-bromo-2-nitropropane-1,3-diol;4,4-dimethyl-1,3-oxazolidine (PubChem CID 11659435) has the molecular formula C8H17BrN2O5 and a molecular weight of 301.14 g/mol. Its IUPAC name is 2-bromo-2-nitropropane-1,3-diol;4,4-dimethyl-1,3-oxazolidine.
| Compound Name | 2-bromo-2-nitropropane-1,3-diol;4,4-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 11659435 |
| Molecular Formula | C8H17BrN2O5 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-bromo-2-nitropropane-1,3-diol;4,4-dimethyl-1,3-oxazolidine |
| SMILES | CC1(C)COCN1.O=[N+]([O-])C(Br)(CO)CO |
| InChI | InChI=1S/C5H11NO.C3H6BrNO4/c1-5(2)3-7-4-6-5;4-3(1-6,2-7)5(8)9/h6H,3-4H2,1-2H3;6-7H,1-2H2 |
| InChIKey | ACDRGBMAJYPTQM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|