C15H12F2N5+ — CID 11659440
1,6-bis(4-fluorophenyl)-1,3,5-triazin-1-ium-2,4-diamine (PubChem CID 11659440) has the molecular formula C15H12F2N5+ and a molecular weight of 300.29 g/mol. Its IUPAC name is 1,6-bis(4-fluorophenyl)-1,3,5-triazin-1-ium-2,4-diamine.
| Compound Name | 1,6-bis(4-fluorophenyl)-1,3,5-triazin-1-ium-2,4-diamine |
|---|---|
| PubChem CID | 11659440 |
| Molecular Formula | C15H12F2N5+ |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1,6-bis(4-fluorophenyl)-1,3,5-triazin-1-ium-2,4-diamine |
| SMILES | Nc1nc(N)[n+](-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H11F2N5/c16-10-3-1-9(2-4-10)13-20-14(18)21-15(19)22(13)12-7-5-11(17)6-8-12/h1-8H,(H3,18,19,21)/p+1 |
| InChIKey | WZXDIDNXKGZFTJ-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|