C12H18N2O7 — CID 11659453
(2R,4S)-4-amino-1-(5-carboxypentanoyl)pyrrolidine-2,4-dicarboxylic acid (PubChem CID 11659453) has the molecular formula C12H18N2O7 and a molecular weight of 302.28 g/mol. Its IUPAC name is (2R,4S)-4-amino-1-(5-carboxypentanoyl)pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | (2R,4S)-4-amino-1-(5-carboxypentanoyl)pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 11659453 |
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (2R,4S)-4-amino-1-(5-carboxypentanoyl)pyrrolidine-2,4-dicarboxylic acid |
| SMILES | N[C@@]1(C(=O)O)C[C@H](C(=O)O)N(C(=O)CCCCC(=O)O)C1 |
| InChI | InChI=1S/C12H18N2O7/c13-12(11(20)21)5-7(10(18)19)14(6-12)8(15)3-1-2-4-9(16)17/h7H,1-6,13H2,(H,16,17)(H,18,19)(H,20,21)/t7-,12+/m1/s1 |
| InChIKey | FTEZFEQPCGPOAW-KRTXAFLBSA-N |
| XLogP | -0.90 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|