C19H21N3O — CID 11659534
3-(diethylamino)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 11659534) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 3-(diethylamino)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 3-(diethylamino)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 11659534 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-(diethylamino)-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CCN(CC)C1N=C(c2ccccc2)c2ccccc2NC1=O |
| InChI | InChI=1S/C19H21N3O/c1-3-22(4-2)18-19(23)20-16-13-9-8-12-15(16)17(21-18)14-10-6-5-7-11-14/h5-13,18H,3-4H2,1-2H3,(H,20,23) |
| InChIKey | OJSRVTPDSDATOH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |