About 7-(aminomethyl)-1,1,1-trifluorononan-5-one
7-(aminomethyl)-1,1,1-trifluorononan-5-one (PubChem CID 116596329) has the molecular formula C10H18F3NO
and a molecular weight of 225.25 g/mol. Its IUPAC name is 7-(aminomethyl)-1,1,1-trifluorononan-5-one.
Molecular Properties
| Compound Name | 7-(aminomethyl)-1,1,1-trifluorononan-5-one |
| PubChem CID | 116596329 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 7-(aminomethyl)-1,1,1-trifluorononan-5-one |
| SMILES | CCC(CN)CC(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-2-8(7-14)6-9(15)4-3-5-10(11,12)13/h8H,2-7,14H2,1H3 |
| InChIKey | NCXIEQLPZBXMJL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(aminomethyl)-1,1,1-trifluorononan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(aminomethyl)-1,1,1-trifluorononan-5-one?
The IUPAC name of 7-(aminomethyl)-1,1,1-trifluorononan-5-one (CID 116596329) is 7-(aminomethyl)-1,1,1-trifluorononan-5-one.
What is the SMILES notation for 7-(aminomethyl)-1,1,1-trifluorononan-5-one?
The canonical SMILES for 7-(aminomethyl)-1,1,1-trifluorononan-5-one is CCC(CN)CC(=O)CCCC(F)(F)F.
What is the InChIKey of 7-(aminomethyl)-1,1,1-trifluorononan-5-one?
The InChIKey is NCXIEQLPZBXMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO/c1-2-8(7-14)6-9(15)4-3-5-10(11,12)13/h8H,2-7,14H2,1H3.
What are the key properties of 7-(aminomethyl)-1,1,1-trifluorononan-5-one?
7-(aminomethyl)-1,1,1-trifluorononan-5-one has a molecular weight of 225.25 g/mol, XLogP of 2.66, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(aminomethyl)-1,1,1-trifluorononan-5-one is sourced from PubChem (CID 116596329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).