C20H20O2Si — CID 11659761
7-methyl-3,3-diphenyl-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one (PubChem CID 11659761) has the molecular formula C20H20O2Si and a molecular weight of 320.46 g/mol. Its IUPAC name is 7-methyl-3,3-diphenyl-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one.
| Compound Name | 7-methyl-3,3-diphenyl-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one |
|---|---|
| PubChem CID | 11659761 |
| Molecular Formula | C20H20O2Si |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 7-methyl-3,3-diphenyl-1,4,4a,5-tetrahydrocyclopenta[d]oxasilin-6-one |
| SMILES | CC1=C2CO[Si](c3ccccc3)(c3ccccc3)CC2CC1=O |
| InChI | InChI=1S/C20H20O2Si/c1-15-19-13-22-23(14-16(19)12-20(15)21,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,16H,12-14H2,1H3 |
| InChIKey | LQABTUZJNCMVBY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|