About 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid
2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid (PubChem CID 11659807) has the molecular formula C13H11BrN2O3
and a molecular weight of 323.15 g/mol. Its IUPAC name is 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid |
| PubChem CID | 11659807 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(Br)ccc31)CCNC2=O |
| InChI | InChI=1S/C13H11BrN2O3/c14-7-1-2-10-9(5-7)8-3-4-15-13(19)12(8)16(10)6-11(17)18/h1-2,5H,3-4,6H2,(H,15,19)(H,17,18) |
| InChIKey | BGMAJDGBENAPRW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid?
The IUPAC name of 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid (CID 11659807) is 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid.
What is the SMILES notation for 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid?
The canonical SMILES for 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid is O=C(O)Cn1c2c(c3cc(Br)ccc31)CCNC2=O.
What is the InChIKey of 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid?
The InChIKey is BGMAJDGBENAPRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN2O3/c14-7-1-2-10-9(5-7)8-3-4-15-13(19)12(8)16(10)6-11(17)18/h1-2,5H,3-4,6H2,(H,15,19)(H,17,18).
What are the key properties of 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid?
2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid has a molecular weight of 323.15 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-1-oxo-3,4-dihydro-2H-pyrido[3,4-b]indol-9-yl)acetic acid is sourced from PubChem (CID 11659807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).