C19H21NO — CID 116598165
2-(4-ethylphenyl)-1-(1,2,3,4-tetrahydroquinolin-4-yl)ethanone (PubChem CID 116598165) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1-(1,2,3,4-tetrahydroquinolin-4-yl)ethanone.
| Compound Name | 2-(4-ethylphenyl)-1-(1,2,3,4-tetrahydroquinolin-4-yl)ethanone |
|---|---|
| PubChem CID | 116598165 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-(4-ethylphenyl)-1-(1,2,3,4-tetrahydroquinolin-4-yl)ethanone |
| SMILES | CCc1ccc(CC(=O)C2CCNc3ccccc32)cc1 |
| InChI | InChI=1S/C19H21NO/c1-2-14-7-9-15(10-8-14)13-19(21)17-11-12-20-18-6-4-3-5-16(17)18/h3-10,17,20H,2,11-13H2,1H3 |
| InChIKey | GBCXFNUCDIBWEL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |