C14H13N3O — CID 116598228
pyrazin-2-yl(1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 116598228) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is pyrazin-2-yl(1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | pyrazin-2-yl(1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 116598228 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | pyrazin-2-yl(1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | O=C(c1cnccn1)C1CCNc2ccccc21 |
| InChI | InChI=1S/C14H13N3O/c18-14(13-9-15-7-8-17-13)11-5-6-16-12-4-2-1-3-10(11)12/h1-4,7-9,11,16H,5-6H2 |
| InChIKey | VIWPEOHUGVGONJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |