C13H23NO — CID 116598551
(1-aminocyclobutyl)-(3,5-dimethylcyclohexyl)methanone (PubChem CID 116598551) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (1-aminocyclobutyl)-(3,5-dimethylcyclohexyl)methanone.
| Compound Name | (1-aminocyclobutyl)-(3,5-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 116598551 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (1-aminocyclobutyl)-(3,5-dimethylcyclohexyl)methanone |
| SMILES | CC1CC(C)CC(C(=O)C2(N)CCC2)C1 |
| InChI | InChI=1S/C13H23NO/c1-9-6-10(2)8-11(7-9)12(15)13(14)4-3-5-13/h9-11H,3-8,14H2,1-2H3 |
| InChIKey | DCDAERINVPSEGI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |