C10H13N3O — CID 116598621
(1-aminocyclobutyl)-(2-amino-3-pyridinyl)methanone (PubChem CID 116598621) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (1-aminocyclobutyl)-(2-amino-3-pyridinyl)methanone.
| Compound Name | (1-aminocyclobutyl)-(2-amino-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 116598621 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (1-aminocyclobutyl)-(2-amino-3-pyridinyl)methanone |
| SMILES | Nc1ncccc1C(=O)C1(N)CCC1 |
| InChI | InChI=1S/C10H13N3O/c11-9-7(3-1-6-13-9)8(14)10(12)4-2-5-10/h1,3,6H,2,4-5,12H2,(H2,11,13) |
| InChIKey | AHKIVZGWMSENHK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |