C13H14ClNO5S — CID 11659974
2,4-dioxopentan-3-yl (1E)-N-(4-chlorophenyl)sulfonylethanimidate (PubChem CID 11659974) has the molecular formula C13H14ClNO5S and a molecular weight of 331.78 g/mol. Its IUPAC name is 2,4-dioxopentan-3-yl (1E)-N-(4-chlorophenyl)sulfonylethanimidate.
| Compound Name | 2,4-dioxopentan-3-yl (1E)-N-(4-chlorophenyl)sulfonylethanimidate |
|---|---|
| PubChem CID | 11659974 |
| Molecular Formula | C13H14ClNO5S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2,4-dioxopentan-3-yl (1E)-N-(4-chlorophenyl)sulfonylethanimidate |
| SMILES | CC(=O)C(O/C(C)=N/S(=O)(=O)c1ccc(Cl)cc1)C(C)=O |
| InChI | InChI=1S/C13H14ClNO5S/c1-8(16)13(9(2)17)20-10(3)15-21(18,19)12-6-4-11(14)5-7-12/h4-7,13H,1-3H3/b15-10+ |
| InChIKey | VYNQQUXFLDARET-XNTDXEJSSA-N |
| XLogP | 2.01 |
| TPSA | 89.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|