C14H16N2O — CID 116600011
3-amino-1-isoquinolin-4-yl-2,2-dimethylpropan-1-one (PubChem CID 116600011) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-amino-1-isoquinolin-4-yl-2,2-dimethylpropan-1-one.
| Compound Name | 3-amino-1-isoquinolin-4-yl-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 116600011 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-amino-1-isoquinolin-4-yl-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CN)C(=O)c1cncc2ccccc12 |
| InChI | InChI=1S/C14H16N2O/c1-14(2,9-15)13(17)12-8-16-7-10-5-3-4-6-11(10)12/h3-8H,9,15H2,1-2H3 |
| InChIKey | WHXWKJSPZVSNCS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |