C14H20N2O — CID 116600244
1-[1-(aminomethyl)cyclobutyl]-2-(5-ethyl-2-pyridinyl)ethanone (PubChem CID 116600244) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-[1-(aminomethyl)cyclobutyl]-2-(5-ethyl-2-pyridinyl)ethanone.
| Compound Name | 1-[1-(aminomethyl)cyclobutyl]-2-(5-ethyl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 116600244 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-[1-(aminomethyl)cyclobutyl]-2-(5-ethyl-2-pyridinyl)ethanone |
| SMILES | CCc1ccc(CC(=O)C2(CN)CCC2)nc1 |
| InChI | InChI=1S/C14H20N2O/c1-2-11-4-5-12(16-9-11)8-13(17)14(10-15)6-3-7-14/h4-5,9H,2-3,6-8,10,15H2,1H3 |
| InChIKey | RLXYZEVGBNGPII-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |