C15H17Br2N3O — CID 116602791
1-(5-amino-2-bromophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanone (PubChem CID 116602791) has the molecular formula C15H17Br2N3O and a molecular weight of 415.13 g/mol. Its IUPAC name is 1-(5-amino-2-bromophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanone.
| Compound Name | 1-(5-amino-2-bromophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 116602791 |
| Molecular Formula | C15H17Br2N3O |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 1-(5-amino-2-bromophenyl)-2-(4-bromo-1,3-diethylpyrazol-5-yl)ethanone |
| SMILES | CCc1nn(CC)c(CC(=O)c2cc(N)ccc2Br)c1Br |
| InChI | InChI=1S/C15H17Br2N3O/c1-3-12-15(17)13(20(4-2)19-12)8-14(21)10-7-9(18)5-6-11(10)16/h5-7H,3-4,8,18H2,1-2H3 |
| InChIKey | YZEABQFSRWHWGH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|