About 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one
1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one (PubChem CID 116604203) has the molecular formula C12H20F3NO
and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one.
Molecular Properties
| Compound Name | 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one |
| PubChem CID | 116604203 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one |
| SMILES | CC1CCC(CN)(C(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3NO/c1-9-2-5-11(8-16,6-3-9)10(17)4-7-12(13,14)15/h9H,2-8,16H2,1H3 |
| InChIKey | SAURXNHOWSOHQG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one?
The IUPAC name of 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one (CID 116604203) is 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one.
What is the SMILES notation for 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one?
The canonical SMILES for 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one is CC1CCC(CN)(C(=O)CCC(F)(F)F)CC1.
What is the InChIKey of 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one?
The InChIKey is SAURXNHOWSOHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO/c1-9-2-5-11(8-16,6-3-9)10(17)4-7-12(13,14)15/h9H,2-8,16H2,1H3.
What are the key properties of 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one?
1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one has a molecular weight of 251.29 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(aminomethyl)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-one is sourced from PubChem (CID 116604203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).