About bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium
bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium (PubChem CID 11660551) has the molecular formula C6H7F6N3O4S2
and a molecular weight of 363.26 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium |
| PubChem CID | 11660551 |
| Molecular Formula | C6H7F6N3O4S2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium |
| SMILES | C[n+]1cc[nH]c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H6N2.C2F6NO4S2/c1-6-3-2-5-4-6;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-4H,1H3;/q;-1/p+1 |
| InChIKey | SDTAXUVLXYGRNE-UHFFFAOYSA-O |
| XLogP | 0.90 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium (CID 11660551) is bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium is C[n+]1cc[nH]c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium?
The InChIKey is SDTAXUVLXYGRNE-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H6N2.C2F6NO4S2/c1-6-3-2-5-4-6;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-4H,1H3;/q;-1/p+1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium?
bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium has a molecular weight of 363.26 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;3-methyl-1H-imidazol-3-ium is sourced from PubChem (CID 11660551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).