About 6-amino-1,1,1-trifluoro-7-methyloctan-4-one
6-amino-1,1,1-trifluoro-7-methyloctan-4-one (PubChem CID 116606419) has the molecular formula C9H16F3NO
and a molecular weight of 211.23 g/mol. Its IUPAC name is 6-amino-1,1,1-trifluoro-7-methyloctan-4-one.
Molecular Properties
| Compound Name | 6-amino-1,1,1-trifluoro-7-methyloctan-4-one |
| PubChem CID | 116606419 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 6-amino-1,1,1-trifluoro-7-methyloctan-4-one |
| SMILES | CC(C)C(N)CC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO/c1-6(2)8(13)5-7(14)3-4-9(10,11)12/h6,8H,3-5,13H2,1-2H3 |
| InChIKey | ODXNXGJVHWWCOO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-amino-1,1,1-trifluoro-7-methyloctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1,1,1-trifluoro-7-methyloctan-4-one?
The IUPAC name of 6-amino-1,1,1-trifluoro-7-methyloctan-4-one (CID 116606419) is 6-amino-1,1,1-trifluoro-7-methyloctan-4-one.
What is the SMILES notation for 6-amino-1,1,1-trifluoro-7-methyloctan-4-one?
The canonical SMILES for 6-amino-1,1,1-trifluoro-7-methyloctan-4-one is CC(C)C(N)CC(=O)CCC(F)(F)F.
What is the InChIKey of 6-amino-1,1,1-trifluoro-7-methyloctan-4-one?
The InChIKey is ODXNXGJVHWWCOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO/c1-6(2)8(13)5-7(14)3-4-9(10,11)12/h6,8H,3-5,13H2,1-2H3.
What are the key properties of 6-amino-1,1,1-trifluoro-7-methyloctan-4-one?
6-amino-1,1,1-trifluoro-7-methyloctan-4-one has a molecular weight of 211.23 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1,1,1-trifluoro-7-methyloctan-4-one is sourced from PubChem (CID 116606419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).