C24H21NO3 — CID 11660719
11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,5,9,11,13,15,17,19,21-decaene (PubChem CID 11660719) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,5,9,11,13,15,17,19,21-decaene.
| Compound Name | 11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,5,9,11,13,15,17,19,21-decaene |
|---|---|
| PubChem CID | 11660719 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 11,13-dimethoxy-7,7-dimethyl-8-oxa-2-azapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1,3,5,9,11,13,15,17,19,21-decaene |
| SMILES | COc1cc2c(c3nc4ccc5ccccc5c4c(OC)c13)C=CC(C)(C)O2 |
| InChI | InChI=1S/C24H21NO3/c1-24(2)12-11-16-18(28-24)13-19(26-3)21-22(16)25-17-10-9-14-7-5-6-8-15(14)20(17)23(21)27-4/h5-13H,1-4H3 |
| InChIKey | USHUVZJRNFSMPQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|