C13H16ClNO — CID 116607206
(2-amino-1-methylcyclopentyl)-(4-chlorophenyl)methanone (PubChem CID 116607206) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is (2-amino-1-methylcyclopentyl)-(4-chlorophenyl)methanone.
| Compound Name | (2-amino-1-methylcyclopentyl)-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 116607206 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (2-amino-1-methylcyclopentyl)-(4-chlorophenyl)methanone |
| SMILES | CC1(C(=O)c2ccc(Cl)cc2)CCCC1N |
| InChI | InChI=1S/C13H16ClNO/c1-13(8-2-3-11(13)15)12(16)9-4-6-10(14)7-5-9/h4-7,11H,2-3,8,15H2,1H3 |
| InChIKey | HTMKJWNBZDBLJD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |