C14H17NOS — CID 116607538
5-amino-1-(1-benzothiophen-7-yl)-4-methylpentan-1-one (PubChem CID 116607538) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 5-amino-1-(1-benzothiophen-7-yl)-4-methylpentan-1-one.
| Compound Name | 5-amino-1-(1-benzothiophen-7-yl)-4-methylpentan-1-one |
|---|---|
| PubChem CID | 116607538 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-amino-1-(1-benzothiophen-7-yl)-4-methylpentan-1-one |
| SMILES | CC(CN)CCC(=O)c1cccc2ccsc12 |
| InChI | InChI=1S/C14H17NOS/c1-10(9-15)5-6-13(16)12-4-2-3-11-7-8-17-14(11)12/h2-4,7-8,10H,5-6,9,15H2,1H3 |
| InChIKey | XKEUOBXHLOAELH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |