About [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate
[2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate (PubChem CID 11660807) has the molecular formula C14H17FN2O9
and a molecular weight of 376.29 g/mol. Its IUPAC name is [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate.
Molecular Properties
| Compound Name | [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate |
| PubChem CID | 11660807 |
| Molecular Formula | C14H17FN2O9 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate |
| SMILES | CCCC(=O)OCOC(=O)COCC(=O)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H17FN2O9/c1-2-3-10(18)25-8-26-12(20)6-23-5-11(19)24-7-17-4-9(15)13(21)16-14(17)22/h4H,2-3,5-8H2,1H3,(H,16,21,22) |
| InChIKey | AJLMZRDFHLLHAP-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate?
The IUPAC name of [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate (CID 11660807) is [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate.
What is the SMILES notation for [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate?
The canonical SMILES for [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate is CCCC(=O)OCOC(=O)COCC(=O)OCn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate?
The InChIKey is AJLMZRDFHLLHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN2O9/c1-2-3-10(18)25-8-26-12(20)6-23-5-11(19)24-7-17-4-9(15)13(21)16-14(17)22/h4H,2-3,5-8H2,1H3,(H,16,21,22).
What are the key properties of [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate?
[2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate has a molecular weight of 376.29 g/mol, XLogP of -0.96, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-2-oxoethoxy]acetyl]oxymethyl butanoate is sourced from PubChem (CID 11660807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).