C11H20F3NO — CID 116608529
7-amino-1,1,1-trifluoro-8,8-dimethylnonan-5-one (PubChem CID 116608529) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 7-amino-1,1,1-trifluoro-8,8-dimethylnonan-5-one.
| Compound Name | 7-amino-1,1,1-trifluoro-8,8-dimethylnonan-5-one |
|---|---|
| PubChem CID | 116608529 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 7-amino-1,1,1-trifluoro-8,8-dimethylnonan-5-one |
| SMILES | CC(C)(C)C(N)CC(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-10(2,3)9(15)7-8(16)5-4-6-11(12,13)14/h9H,4-7,15H2,1-3H3 |
| InChIKey | UMWBOSDOPGQSEN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |