C10H18F3NO — CID 116608584
6-amino-1,1,1-trifluoro-7,7-dimethyloctan-4-one (PubChem CID 116608584) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is 6-amino-1,1,1-trifluoro-7,7-dimethyloctan-4-one.
| Compound Name | 6-amino-1,1,1-trifluoro-7,7-dimethyloctan-4-one |
|---|---|
| PubChem CID | 116608584 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 6-amino-1,1,1-trifluoro-7,7-dimethyloctan-4-one |
| SMILES | CC(C)(C)C(N)CC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO/c1-9(2,3)8(14)6-7(15)4-5-10(11,12)13/h8H,4-6,14H2,1-3H3 |
| InChIKey | VTFZBDZZPSSXBE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |