C21H30O6 — CID 11660862
methyl 5-[(6aR,7R,8S,10aS)-7,8-dimethyl-3,9-dioxo-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-7-yl]-3-(hydroxymethyl)pentanoate (PubChem CID 11660862) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is methyl 5-[(6aR,7R,8S,10aS)-7,8-dimethyl-3,9-dioxo-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-7-yl]-3-(hydroxymethyl)pentanoate.
| Compound Name | methyl 5-[(6aR,7R,8S,10aS)-7,8-dimethyl-3,9-dioxo-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-7-yl]-3-(hydroxymethyl)pentanoate |
|---|---|
| PubChem CID | 11660862 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | methyl 5-[(6aR,7R,8S,10aS)-7,8-dimethyl-3,9-dioxo-1,5,6,6a,8,10-hexahydrobenzo[d][2]benzofuran-7-yl]-3-(hydroxymethyl)pentanoate |
| SMILES | COC(=O)CC(CO)CC[C@@]1(C)[C@H](C)C(=O)C[C@@]23COC(=O)C2=CCC[C@@H]31 |
| InChI | InChI=1S/C21H30O6/c1-13-16(23)10-21-12-27-19(25)15(21)5-4-6-17(21)20(13,2)8-7-14(11-22)9-18(24)26-3/h5,13-14,17,22H,4,6-12H2,1-3H3/t13-,14?,17-,20+,21-/m1/s1 |
| InChIKey | LOJULOSPWTXYPL-ZOXDONLSSA-N |
| XLogP | 2.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |