About 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione
5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione (PubChem CID 11660936) has the molecular formula C20H22N4O4
and a molecular weight of 382.42 g/mol. Its IUPAC name is 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione |
| PubChem CID | 11660936 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc(N2C(=O)N(Cc3ccncc3)C(C)(C)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O4/c1-13(2)16-6-5-15(11-17(16)24(27)28)23-18(25)20(3,4)22(19(23)26)12-14-7-9-21-10-8-14/h5-11,13H,12H2,1-4H3 |
| InChIKey | ATZQRCMRPQRIHD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione?
The IUPAC name of 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione (CID 11660936) is 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione?
The canonical SMILES for 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione is CC(C)c1ccc(N2C(=O)N(Cc3ccncc3)C(C)(C)C2=O)cc1[N+](=O)[O-].
What is the InChIKey of 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione?
The InChIKey is ATZQRCMRPQRIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O4/c1-13(2)16-6-5-15(11-17(16)24(27)28)23-18(25)20(3,4)22(19(23)26)12-14-7-9-21-10-8-14/h5-11,13H,12H2,1-4H3.
What are the key properties of 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione?
5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione has a molecular weight of 382.42 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-(3-nitro-4-propan-2-ylphenyl)-1-(pyridin-4-ylmethyl)imidazolidine-2,4-dione is sourced from PubChem (CID 11660936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).