C12H9Cl2NOS — CID 116609801
(4-amino-3,5-dichlorophenyl)-(5-methylthiophen-2-yl)methanone (PubChem CID 116609801) has the molecular formula C12H9Cl2NOS and a molecular weight of 286.18 g/mol. Its IUPAC name is (4-amino-3,5-dichlorophenyl)-(5-methylthiophen-2-yl)methanone.
| Compound Name | (4-amino-3,5-dichlorophenyl)-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 116609801 |
| Molecular Formula | C12H9Cl2NOS |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | (4-amino-3,5-dichlorophenyl)-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(Cl)c(N)c(Cl)c2)s1 |
| InChI | InChI=1S/C12H9Cl2NOS/c1-6-2-3-10(17-6)12(16)7-4-8(13)11(15)9(14)5-7/h2-5H,15H2,1H3 |
| InChIKey | AXPCGCAFDKSROI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|