C22H31N3O3 — CID 11661007
2-[4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 11661007) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-[4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 2-[4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 11661007 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-[4-[2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1C2CCCN2C(=O)N1CCCCNCCOc1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H31N3O3/c26-21-19-10-6-15-24(19)22(27)25(21)14-4-3-12-23-13-16-28-20-11-5-8-17-7-1-2-9-18(17)20/h5,8,11,19,23H,1-4,6-7,9-10,12-16H2 |
| InChIKey | HAWLNWMPWCIBNB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|